C13H15ClN4O3 — CID 103160482
4-[5-(2-chloro-3-methylphenyl)tetrazol-1-yl]-3-methoxybutanoic acid (PubChem CID 103160482) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is 4-[5-(2-chloro-3-methylphenyl)tetrazol-1-yl]-3-methoxybutanoic acid.
| Compound Name | 4-[5-(2-chloro-3-methylphenyl)tetrazol-1-yl]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103160482 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[5-(2-chloro-3-methylphenyl)tetrazol-1-yl]-3-methoxybutanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1-c1cccc(C)c1Cl |
| InChI | InChI=1S/C13H15ClN4O3/c1-8-4-3-5-10(12(8)14)13-15-16-17-18(13)7-9(21-2)6-11(19)20/h3-5,9H,6-7H2,1-2H3,(H,19,20) |
| InChIKey | IUFLNWKPUVIFGO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |