C11H13BrN4O3S — CID 103160447
4-[5-(5-bromo-4-methylthiophen-2-yl)tetrazol-1-yl]-3-methoxybutanoic acid (PubChem CID 103160447) has the molecular formula C11H13BrN4O3S and a molecular weight of 361.22 g/mol. Its IUPAC name is 4-[5-(5-bromo-4-methylthiophen-2-yl)tetrazol-1-yl]-3-methoxybutanoic acid.
| Compound Name | 4-[5-(5-bromo-4-methylthiophen-2-yl)tetrazol-1-yl]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103160447 |
| Molecular Formula | C11H13BrN4O3S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 4-[5-(5-bromo-4-methylthiophen-2-yl)tetrazol-1-yl]-3-methoxybutanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1-c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C11H13BrN4O3S/c1-6-3-8(20-10(6)12)11-13-14-15-16(11)5-7(19-2)4-9(17)18/h3,7H,4-5H2,1-2H3,(H,17,18) |
| InChIKey | HNNWFHWKLYZHJM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |