4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid

C12H12Cl2N4O3 — CID 103160413

IUPAC4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid
SMILESCOC(CC(=O)O)Cn1nnnc1-c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C12H12Cl2N4O3/c1-21-10(5-11(19)20)6-18-12(15-16-17-18)7-2-8(13)4-9(14)3-7/h2-4,10H,5-6H2,1H3,(H,19,20)
InChIKeyCNLYAAOMMWDQTN-UHFFFAOYSA-N
MW331.16 g/mol
LogP2.14
Rot. Bonds6

About 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid

4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid (PubChem CID 103160413) has the molecular formula C12H12Cl2N4O3 and a molecular weight of 331.16 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid.

Molecular Properties

Compound Name4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid
PubChem CID103160413
Molecular FormulaC12H12Cl2N4O3
Molecular Weight331.16 g/mol
Exact Mass330.03
IUPAC Name4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid
SMILESCOC(CC(=O)O)Cn1nnnc1-c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C12H12Cl2N4O3/c1-21-10(5-11(19)20)6-18-12(15-16-17-18)7-2-8(13)4-9(14)3-7/h2-4,10H,5-6H2,1H3,(H,19,20)
InChIKeyCNLYAAOMMWDQTN-UHFFFAOYSA-N
XLogP2.14
TPSA90.13 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.16
LogP ≤ 52.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid?
The IUPAC name of 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid (CID 103160413) is 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid.
What is the SMILES notation for 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid?
The canonical SMILES for 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid is COC(CC(=O)O)Cn1nnnc1-c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid?
The InChIKey is CNLYAAOMMWDQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N4O3/c1-21-10(5-11(19)20)6-18-12(15-16-17-18)7-2-8(13)4-9(14)3-7/h2-4,10H,5-6H2,1H3,(H,19,20).
What are the key properties of 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid?
4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid has a molecular weight of 331.16 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid is sourced from PubChem (CID 103160413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).