C12H12Cl2N4O3 — CID 103160413
4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid (PubChem CID 103160413) has the molecular formula C12H12Cl2N4O3 and a molecular weight of 331.16 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid.
| Compound Name | 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103160413 |
| Molecular Formula | C12H12Cl2N4O3 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N4O3/c1-21-10(5-11(19)20)6-18-12(15-16-17-18)7-2-8(13)4-9(14)3-7/h2-4,10H,5-6H2,1H3,(H,19,20) |
| InChIKey | CNLYAAOMMWDQTN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |