C10H12N4O4 — CID 103160591
4-[5-(furan-3-yl)tetrazol-1-yl]-3-methoxybutanoic acid (PubChem CID 103160591) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 4-[5-(furan-3-yl)tetrazol-1-yl]-3-methoxybutanoic acid.
| Compound Name | 4-[5-(furan-3-yl)tetrazol-1-yl]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103160591 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-[5-(furan-3-yl)tetrazol-1-yl]-3-methoxybutanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1-c1ccoc1 |
| InChI | InChI=1S/C10H12N4O4/c1-17-8(4-9(15)16)5-14-10(11-12-13-14)7-2-3-18-6-7/h2-3,6,8H,4-5H2,1H3,(H,15,16) |
| InChIKey | VTPNEHMYFBQJTL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |