C11H14N4O4 — CID 114227252
3-ethoxy-4-[5-(furan-3-yl)tetrazol-1-yl]butanoic acid (PubChem CID 114227252) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-ethoxy-4-[5-(furan-3-yl)tetrazol-1-yl]butanoic acid.
| Compound Name | 3-ethoxy-4-[5-(furan-3-yl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 114227252 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-ethoxy-4-[5-(furan-3-yl)tetrazol-1-yl]butanoic acid |
| SMILES | CCOC(CC(=O)O)Cn1nnnc1-c1ccoc1 |
| InChI | InChI=1S/C11H14N4O4/c1-2-19-9(5-10(16)17)6-15-11(12-13-14-15)8-3-4-18-7-8/h3-4,7,9H,2,5-6H2,1H3,(H,16,17) |
| InChIKey | OZRPGRAOXDOTEY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |