C11H13ClN4O3 — CID 106690589
3-[[5-(5-chlorofuran-2-yl)tetrazol-1-yl]methyl]pentanoic acid (PubChem CID 106690589) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 3-[[5-(5-chlorofuran-2-yl)tetrazol-1-yl]methyl]pentanoic acid.
| Compound Name | 3-[[5-(5-chlorofuran-2-yl)tetrazol-1-yl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 106690589 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[[5-(5-chlorofuran-2-yl)tetrazol-1-yl]methyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)Cn1nnnc1-c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H13ClN4O3/c1-2-7(5-10(17)18)6-16-11(13-14-15-16)8-3-4-9(12)19-8/h3-4,7H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | UVTRLBQYXQDBEU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |