C11H14N4O3S — CID 81139740
4-[5-(4-methoxythiophen-2-yl)tetrazol-1-yl]-3-methylbutanoic acid (PubChem CID 81139740) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-[5-(4-methoxythiophen-2-yl)tetrazol-1-yl]-3-methylbutanoic acid.
| Compound Name | 4-[5-(4-methoxythiophen-2-yl)tetrazol-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81139740 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-[5-(4-methoxythiophen-2-yl)tetrazol-1-yl]-3-methylbutanoic acid |
| SMILES | COc1csc(-c2nnnn2CC(C)CC(=O)O)c1 |
| InChI | InChI=1S/C11H14N4O3S/c1-7(3-10(16)17)5-15-11(12-13-14-15)9-4-8(18-2)6-19-9/h4,6-7H,3,5H2,1-2H3,(H,16,17) |
| InChIKey | SNWLJWNZWWWEGY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |