C11H20N4O2 — CID 114877455
3-methyl-4-[5-(2-methylbutyl)tetrazol-1-yl]butanoic acid (PubChem CID 114877455) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-methyl-4-[5-(2-methylbutyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 3-methyl-4-[5-(2-methylbutyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 114877455 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-methyl-4-[5-(2-methylbutyl)tetrazol-1-yl]butanoic acid |
| SMILES | CCC(C)Cc1nnnn1CC(C)CC(=O)O |
| InChI | InChI=1S/C11H20N4O2/c1-4-8(2)5-10-12-13-14-15(10)7-9(3)6-11(16)17/h8-9H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | ZQQRGNGQTIICMZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |