C13H24N4O2 — CID 81070338
4-(5-heptan-3-yltetrazol-1-yl)-3-methylbutanoic acid (PubChem CID 81070338) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(5-heptan-3-yltetrazol-1-yl)-3-methylbutanoic acid.
| Compound Name | 4-(5-heptan-3-yltetrazol-1-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81070338 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-(5-heptan-3-yltetrazol-1-yl)-3-methylbutanoic acid |
| SMILES | CCCCC(CC)c1nnnn1CC(C)CC(=O)O |
| InChI | InChI=1S/C13H24N4O2/c1-4-6-7-11(5-2)13-14-15-16-17(13)9-10(3)8-12(18)19/h10-11H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | KERVHYIIRRNMLC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |