C13H24N4O2 — CID 79791413
2-(5-heptan-3-yltetrazol-1-yl)-2-methylbutanoic acid (PubChem CID 79791413) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(5-heptan-3-yltetrazol-1-yl)-2-methylbutanoic acid.
| Compound Name | 2-(5-heptan-3-yltetrazol-1-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79791413 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-(5-heptan-3-yltetrazol-1-yl)-2-methylbutanoic acid |
| SMILES | CCCCC(CC)c1nnnn1C(C)(CC)C(=O)O |
| InChI | InChI=1S/C13H24N4O2/c1-5-8-9-10(6-2)11-14-15-16-17(11)13(4,7-3)12(18)19/h10H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | BQOIDHZMYGIZSZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |