C12H22N4O2 — CID 66046773
4-[5-(2,3,3-trimethylbutyl)tetrazol-1-yl]butanoic acid (PubChem CID 66046773) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-[5-(2,3,3-trimethylbutyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 4-[5-(2,3,3-trimethylbutyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 66046773 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-[5-(2,3,3-trimethylbutyl)tetrazol-1-yl]butanoic acid |
| SMILES | CC(Cc1nnnn1CCCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H22N4O2/c1-9(12(2,3)4)8-10-13-14-15-16(10)7-5-6-11(17)18/h9H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | OOSLESDORBWOSJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |