3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid

C18H18N4O2 — CID 94970264

IUPAC3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid
SMILESO=C(O)CCn1nnnc1CC(c1ccccc1)c1ccccc1
InChIInChI=1S/C18H18N4O2/c23-18(24)11-12-22-17(19-20-21-22)13-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,23,24)
InChIKeyLMEQMRZEHBZMGY-UHFFFAOYSA-N
MW322.37 g/mol
LogP2.52
Rot. Bonds7

About 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid

3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid (PubChem CID 94970264) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid
PubChem CID94970264
Molecular FormulaC18H18N4O2
Molecular Weight322.37 g/mol
Exact Mass322.14
IUPAC Name3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid
SMILESO=C(O)CCn1nnnc1CC(c1ccccc1)c1ccccc1
InChIInChI=1S/C18H18N4O2/c23-18(24)11-12-22-17(19-20-21-22)13-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,23,24)
InChIKeyLMEQMRZEHBZMGY-UHFFFAOYSA-N
XLogP2.52
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.37
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid?
The IUPAC name of 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid (CID 94970264) is 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid.
What is the SMILES notation for 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid?
The canonical SMILES for 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid is O=C(O)CCn1nnnc1CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid?
The InChIKey is LMEQMRZEHBZMGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2/c23-18(24)11-12-22-17(19-20-21-22)13-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,23,24).
What are the key properties of 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid?
3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid has a molecular weight of 322.37 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid is sourced from PubChem (CID 94970264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).