C18H18N4O2 — CID 94970264
3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid (PubChem CID 94970264) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid.
| Compound Name | 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 94970264 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[5-(2,2-diphenylethyl)tetrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1nnnc1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2/c23-18(24)11-12-22-17(19-20-21-22)13-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,23,24) |
| InChIKey | LMEQMRZEHBZMGY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |