C16H20O — CID 66047163
6-(2-methylidenebutyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 66047163) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 6-(2-methylidenebutyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 6-(2-methylidenebutyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 66047163 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 6-(2-methylidenebutyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | C=C(CC)CC1CCCc2ccccc2C1=O |
| InChI | InChI=1S/C16H20O/c1-3-12(2)11-14-9-6-8-13-7-4-5-10-15(13)16(14)17/h4-5,7,10,14H,2-3,6,8-9,11H2,1H3 |
| InChIKey | UMIOPZKVSLHPGS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|