C16H14Cl4 — CID 66049437
1,3-dichloro-2-[2-(chloromethyl)-3-(3-chlorophenyl)propyl]benzene (PubChem CID 66049437) has the molecular formula C16H14Cl4 and a molecular weight of 348.10 g/mol. Its IUPAC name is 1,3-dichloro-2-[2-(chloromethyl)-3-(3-chlorophenyl)propyl]benzene.
| Compound Name | 1,3-dichloro-2-[2-(chloromethyl)-3-(3-chlorophenyl)propyl]benzene |
|---|---|
| PubChem CID | 66049437 |
| Molecular Formula | C16H14Cl4 |
| Molecular Weight | 348.10 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 1,3-dichloro-2-[2-(chloromethyl)-3-(3-chlorophenyl)propyl]benzene |
| SMILES | ClCC(Cc1cccc(Cl)c1)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H14Cl4/c17-10-12(7-11-3-1-4-13(18)8-11)9-14-15(19)5-2-6-16(14)20/h1-6,8,12H,7,9-10H2 |
| InChIKey | ONHSMNOYHFDKSN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.10 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|