About 4-(bromomethyl)tridecane
4-(bromomethyl)tridecane (PubChem CID 66049847) has the molecular formula C14H29Br
and a molecular weight of 277.29 g/mol. Its IUPAC name is 4-(bromomethyl)tridecane.
Molecular Properties
| Compound Name | 4-(bromomethyl)tridecane |
| PubChem CID | 66049847 |
| Molecular Formula | C14H29Br |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-(bromomethyl)tridecane |
| SMILES | CCCCCCCCCC(CBr)CCC |
| InChI | InChI=1S/C14H29Br/c1-3-5-6-7-8-9-10-12-14(13-15)11-4-2/h14H,3-13H2,1-2H3 |
| InChIKey | RSGVFBCVVYVINC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)tridecane?
The IUPAC name of 4-(bromomethyl)tridecane (CID 66049847) is 4-(bromomethyl)tridecane.
What is the SMILES notation for 4-(bromomethyl)tridecane?
The canonical SMILES for 4-(bromomethyl)tridecane is CCCCCCCCCC(CBr)CCC.
What is the InChIKey of 4-(bromomethyl)tridecane?
The InChIKey is RSGVFBCVVYVINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29Br/c1-3-5-6-7-8-9-10-12-14(13-15)11-4-2/h14H,3-13H2,1-2H3.
What are the key properties of 4-(bromomethyl)tridecane?
4-(bromomethyl)tridecane has a molecular weight of 277.29 g/mol, XLogP of 5.94, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)tridecane is sourced from PubChem (CID 66049847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).