About azane;4-(bromomethyl)octane
azane;4-(bromomethyl)octane (PubChem CID 88699989) has the molecular formula C9H22BrN
and a molecular weight of 224.19 g/mol. Its IUPAC name is azane;4-(bromomethyl)octane.
Molecular Properties
| Compound Name | azane;4-(bromomethyl)octane |
| PubChem CID | 88699989 |
| Molecular Formula | C9H22BrN |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | azane;4-(bromomethyl)octane |
| SMILES | CCCCC(CBr)CCC.N |
| InChI | InChI=1S/C9H19Br.H3N/c1-3-5-7-9(8-10)6-4-2;/h9H,3-8H2,1-2H3;1H3 |
| InChIKey | IFBZQYKVNOZOOF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;4-(bromomethyl)octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(bromomethyl)octane?
The IUPAC name of azane;4-(bromomethyl)octane (CID 88699989) is azane;4-(bromomethyl)octane.
What is the SMILES notation for azane;4-(bromomethyl)octane?
The canonical SMILES for azane;4-(bromomethyl)octane is CCCCC(CBr)CCC.N.
What is the InChIKey of azane;4-(bromomethyl)octane?
The InChIKey is IFBZQYKVNOZOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19Br.H3N/c1-3-5-7-9(8-10)6-4-2;/h9H,3-8H2,1-2H3;1H3.
What are the key properties of azane;4-(bromomethyl)octane?
azane;4-(bromomethyl)octane has a molecular weight of 224.19 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(bromomethyl)octane is sourced from PubChem (CID 88699989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).