About ethane;2-methyl-5-propylnonane
ethane;2-methyl-5-propylnonane (PubChem CID 171073854) has the molecular formula C15H34
and a molecular weight of 214.44 g/mol. Its IUPAC name is ethane;2-methyl-5-propylnonane.
Molecular Properties
| Compound Name | ethane;2-methyl-5-propylnonane |
| PubChem CID | 171073854 |
| Molecular Formula | C15H34 |
| Molecular Weight | 214.44 g/mol |
| Exact Mass | 214.27 |
| IUPAC Name | ethane;2-methyl-5-propylnonane |
| SMILES | CC.CCCCC(CCC)CCC(C)C |
| InChI | InChI=1S/C13H28.C2H6/c1-5-7-9-13(8-6-2)11-10-12(3)4;1-2/h12-13H,5-11H2,1-4H3;1-2H3 |
| InChIKey | HAZUTXPBQCXQOX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methyl-5-propylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-5-propylnonane?
The IUPAC name of ethane;2-methyl-5-propylnonane (CID 171073854) is ethane;2-methyl-5-propylnonane.
What is the SMILES notation for ethane;2-methyl-5-propylnonane?
The canonical SMILES for ethane;2-methyl-5-propylnonane is CC.CCCCC(CCC)CCC(C)C.
What is the InChIKey of ethane;2-methyl-5-propylnonane?
The InChIKey is HAZUTXPBQCXQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28.C2H6/c1-5-7-9-13(8-6-2)11-10-12(3)4;1-2/h12-13H,5-11H2,1-4H3;1-2H3.
What are the key properties of ethane;2-methyl-5-propylnonane?
ethane;2-methyl-5-propylnonane has a molecular weight of 214.44 g/mol, XLogP of 6.06, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5-propylnonane is sourced from PubChem (CID 171073854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).