About 7-butyl-4-methylundecane
7-butyl-4-methylundecane (PubChem CID 59977721) has the molecular formula C16H34
and a molecular weight of 226.45 g/mol. Its IUPAC name is 7-butyl-4-methylundecane.
Molecular Properties
| Compound Name | 7-butyl-4-methylundecane |
| PubChem CID | 59977721 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 7-butyl-4-methylundecane |
| SMILES | CCCCC(CCCC)CCC(C)CCC |
| InChI | InChI=1S/C16H34/c1-5-8-11-16(12-9-6-2)14-13-15(4)10-7-3/h15-16H,5-14H2,1-4H3 |
| InChIKey | ZUBIYIRYCUNDMY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-butyl-4-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-4-methylundecane?
The IUPAC name of 7-butyl-4-methylundecane (CID 59977721) is 7-butyl-4-methylundecane.
What is the SMILES notation for 7-butyl-4-methylundecane?
The canonical SMILES for 7-butyl-4-methylundecane is CCCCC(CCCC)CCC(C)CCC.
What is the InChIKey of 7-butyl-4-methylundecane?
The InChIKey is ZUBIYIRYCUNDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34/c1-5-8-11-16(12-9-6-2)14-13-15(4)10-7-3/h15-16H,5-14H2,1-4H3.
What are the key properties of 7-butyl-4-methylundecane?
7-butyl-4-methylundecane has a molecular weight of 226.45 g/mol, XLogP of 6.20, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-4-methylundecane is sourced from PubChem (CID 59977721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).