C10H18N4O3S — CID 66052749
5-[(dimethylamino)methyl]-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-ol (PubChem CID 66052749) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66052749 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-(1H-pyrazol-4-ylsulfonyl)pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H18N4O3S/c1-13(2)6-8-3-9(15)7-14(8)18(16,17)10-4-11-12-5-10/h4-5,8-9,15H,3,6-7H2,1-2H3,(H,11,12) |
| InChIKey | CWEPCEFEEFODOK-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |