C11H9ClFNS2 — CID 66052848
4-(chloromethyl)-2-[(2-fluorophenyl)sulfanylmethyl]-1,3-thiazole (PubChem CID 66052848) has the molecular formula C11H9ClFNS2 and a molecular weight of 273.78 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(2-fluorophenyl)sulfanylmethyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[(2-fluorophenyl)sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 66052848 |
| Molecular Formula | C11H9ClFNS2 |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 4-(chloromethyl)-2-[(2-fluorophenyl)sulfanylmethyl]-1,3-thiazole |
| SMILES | Fc1ccccc1SCc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H9ClFNS2/c12-5-8-6-16-11(14-8)7-15-10-4-2-1-3-9(10)13/h1-4,6H,5,7H2 |
| InChIKey | ZVHFDARAGUMQRN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|