About 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole
2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole (PubChem CID 66056538) has the molecular formula C13H13F2NO2S
and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole |
| PubChem CID | 66056538 |
| Molecular Formula | C13H13F2NO2S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole |
| SMILES | COC(OC)c1csc(Cc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C13H13F2NO2S/c1-17-13(18-2)11-7-19-12(16-11)5-8-3-9(14)6-10(15)4-8/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | XZITVWUXNPVXGX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole?
The IUPAC name of 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole (CID 66056538) is 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole.
What is the SMILES notation for 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole?
The canonical SMILES for 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole is COC(OC)c1csc(Cc2cc(F)cc(F)c2)n1.
What is the InChIKey of 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole?
The InChIKey is XZITVWUXNPVXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NO2S/c1-17-13(18-2)11-7-19-12(16-11)5-8-3-9(14)6-10(15)4-8/h3-4,6-7,13H,5H2,1-2H3.
What are the key properties of 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole?
2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole has a molecular weight of 285.32 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-difluorophenyl)methyl]-4-(dimethoxymethyl)-1,3-thiazole is sourced from PubChem (CID 66056538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).