C13H23BrN2O — CID 66058089
2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]-2-ethylbutan-1-ol (PubChem CID 66058089) has the molecular formula C13H23BrN2O and a molecular weight of 303.24 g/mol. Its IUPAC name is 2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 66058089 |
| Molecular Formula | C13H23BrN2O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]-2-ethylbutan-1-ol |
| SMILES | CCn1nc(C)c(Br)c1CC(CC)(CC)CO |
| InChI | InChI=1S/C13H23BrN2O/c1-5-13(6-2,9-17)8-11-12(14)10(4)15-16(11)7-3/h17H,5-9H2,1-4H3 |
| InChIKey | IEWCLXDPCYLZIF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |