C15H21N3O — CID 66058099
2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-phenylbutan-1-ol (PubChem CID 66058099) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-phenylbutan-1-ol.
| Compound Name | 2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-phenylbutan-1-ol |
|---|---|
| PubChem CID | 66058099 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-phenylbutan-1-ol |
| SMILES | CCn1ncnc1CC(CC)(CO)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O/c1-3-15(11-19,13-8-6-5-7-9-13)10-14-16-12-17-18(14)4-2/h5-9,12,19H,3-4,10-11H2,1-2H3 |
| InChIKey | RLDHULCRCLHGNK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |