C16H15Cl2FO — CID 66059249
2-[(2,5-dichlorophenyl)methyl]-3-(4-fluorophenyl)propan-1-ol (PubChem CID 66059249) has the molecular formula C16H15Cl2FO and a molecular weight of 313.20 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl]-3-(4-fluorophenyl)propan-1-ol.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl]-3-(4-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66059249 |
| Molecular Formula | C16H15Cl2FO |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl]-3-(4-fluorophenyl)propan-1-ol |
| SMILES | OCC(Cc1ccc(F)cc1)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H15Cl2FO/c17-14-3-6-16(18)13(9-14)8-12(10-20)7-11-1-4-15(19)5-2-11/h1-6,9,12,20H,7-8,10H2 |
| InChIKey | GUISSNOZRRLMEC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |