C15H12Cl2F2O — CID 65321219
1-(2,5-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-ol (PubChem CID 65321219) has the molecular formula C15H12Cl2F2O and a molecular weight of 317.16 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-ol.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 65321219 |
| Molecular Formula | C15H12Cl2F2O |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(3,5-difluorophenyl)propan-2-ol |
| SMILES | OC(Cc1cc(F)cc(F)c1)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2F2O/c16-11-1-2-15(17)10(6-11)7-14(20)5-9-3-12(18)8-13(19)4-9/h1-4,6,8,14,20H,5,7H2 |
| InChIKey | ZFLVQFBNGXWDMG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |