C14H16N2O5 — CID 66060981
4-[2-(4-methoxyphenoxy)acetyl]-3-methylpiperazine-2,6-dione (PubChem CID 66060981) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenoxy)acetyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[2-(4-methoxyphenoxy)acetyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66060981 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[2-(4-methoxyphenoxy)acetyl]-3-methylpiperazine-2,6-dione |
| SMILES | COc1ccc(OCC(=O)N2CC(=O)NC(=O)C2C)cc1 |
| InChI | InChI=1S/C14H16N2O5/c1-9-14(19)15-12(17)7-16(9)13(18)8-21-11-5-3-10(20-2)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,15,17,19) |
| InChIKey | GMHRLZMPZKSSLU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|