C14H11FN2O4 — CID 66063008
4-[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]piperazine-2,6-dione (PubChem CID 66063008) has the molecular formula C14H11FN2O4 and a molecular weight of 290.25 g/mol. Its IUPAC name is 4-[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]piperazine-2,6-dione.
| Compound Name | 4-[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063008 |
| Molecular Formula | C14H11FN2O4 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2cc(C#CCO)ccc2F)CC(=O)N1 |
| InChI | InChI=1S/C14H11FN2O4/c15-11-4-3-9(2-1-5-18)6-10(11)14(21)17-7-12(19)16-13(20)8-17/h3-4,6,18H,5,7-8H2,(H,16,19,20) |
| InChIKey | NIZFHVBMWXPPGZ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|