C11H10Br2N2O3S — CID 66068729
4-(4,5-dibromothiophene-2-carbonyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66068729) has the molecular formula C11H10Br2N2O3S and a molecular weight of 410.09 g/mol. Its IUPAC name is 4-(4,5-dibromothiophene-2-carbonyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(4,5-dibromothiophene-2-carbonyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66068729 |
| Molecular Formula | C11H10Br2N2O3S |
| Molecular Weight | 410.09 g/mol |
| Exact Mass | 407.88 |
| IUPAC Name | 4-(4,5-dibromothiophene-2-carbonyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H10Br2N2O3S/c1-2-6-10(17)14-8(16)4-15(6)11(18)7-3-5(12)9(13)19-7/h3,6H,2,4H2,1H3,(H,14,16,17) |
| InChIKey | IWBRFFISQPJIPB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|