C12H17BrN4O2 — CID 66069010
1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-ethylpiperazine-2,6-dione (PubChem CID 66069010) has the molecular formula C12H17BrN4O2 and a molecular weight of 329.20 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069010 |
| Molecular Formula | C12H17BrN4O2 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1NCC(=O)N(Cc2c(Br)c(C)nn2C)C1=O |
| InChI | InChI=1S/C12H17BrN4O2/c1-4-8-12(19)17(10(18)5-14-8)6-9-11(13)7(2)15-16(9)3/h8,14H,4-6H2,1-3H3 |
| InChIKey | UUQHHNNTIXWGOS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|