C12H22N2O2 — CID 66069806
1-(3,3-dimethylbutyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66069806) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 1-(3,3-dimethylbutyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069806 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC(C)(C)CCN1C(=O)CNC(C)(C)C1=O |
| InChI | InChI=1S/C12H22N2O2/c1-11(2,3)6-7-14-9(15)8-13-12(4,5)10(14)16/h13H,6-8H2,1-5H3 |
| InChIKey | LALVOTNEQAVVDL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|