C11H13FN2S — CID 66070262
N'-cyclopropyl-2-(3-fluorophenyl)sulfanylethanimidamide (PubChem CID 66070262) has the molecular formula C11H13FN2S and a molecular weight of 224.30 g/mol. Its IUPAC name is N'-cyclopropyl-2-(3-fluorophenyl)sulfanylethanimidamide.
| Compound Name | N'-cyclopropyl-2-(3-fluorophenyl)sulfanylethanimidamide |
|---|---|
| PubChem CID | 66070262 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N'-cyclopropyl-2-(3-fluorophenyl)sulfanylethanimidamide |
| SMILES | N/C(CSc1cccc(F)c1)=N\C1CC1 |
| InChI | InChI=1S/C11H13FN2S/c12-8-2-1-3-10(6-8)15-7-11(13)14-9-4-5-9/h1-3,6,9H,4-5,7H2,(H2,13,14) |
| InChIKey | GHUZUXJULLQKEP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|