C16H18FNS — CID 66071589
1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)sulfanylethanamine (PubChem CID 66071589) has the molecular formula C16H18FNS and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)sulfanylethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 66071589 |
| Molecular Formula | C16H18FNS |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-(4-fluorophenyl)sulfanylethanamine |
| SMILES | Cc1cc(C)cc(C(N)CSc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H18FNS/c1-11-7-12(2)9-13(8-11)16(18)10-19-15-5-3-14(17)4-6-15/h3-9,16H,10,18H2,1-2H3 |
| InChIKey | JXEAUSUJXNXLKZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |