C13H20N4O4 — CID 66075175
3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)piperidine-1-carboxamide (PubChem CID 66075175) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)piperidine-1-carboxamide.
| Compound Name | 3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 66075175 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)piperidine-1-carboxamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)C1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C13H20N4O4/c1-13(2)11(20)15-9(18)7-17(13)10(19)8-4-3-5-16(6-8)12(14)21/h8H,3-7H2,1-2H3,(H2,14,21)(H,15,18,20) |
| InChIKey | ALAZJKPLCUCIJZ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|