C9H16N2O2 — CID 66075671
3-methyl-1-(2-methylpropyl)piperazine-2,6-dione (PubChem CID 66075671) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-methyl-1-(2-methylpropyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-1-(2-methylpropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66075671 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-methyl-1-(2-methylpropyl)piperazine-2,6-dione |
| SMILES | CC(C)CN1C(=O)CNC(C)C1=O |
| InChI | InChI=1S/C9H16N2O2/c1-6(2)5-11-8(12)4-10-7(3)9(11)13/h6-7,10H,4-5H2,1-3H3 |
| InChIKey | DZCQSUJJTBOEDN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|