C15H10ClIN2O2 — CID 66081022
1-(1,3-benzodioxol-5-yl)-2-(chloromethyl)-5-iodobenzimidazole (PubChem CID 66081022) has the molecular formula C15H10ClIN2O2 and a molecular weight of 412.61 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(chloromethyl)-5-iodobenzimidazole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(chloromethyl)-5-iodobenzimidazole |
|---|---|
| PubChem CID | 66081022 |
| Molecular Formula | C15H10ClIN2O2 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(chloromethyl)-5-iodobenzimidazole |
| SMILES | ClCc1nc2cc(I)ccc2n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H10ClIN2O2/c16-7-15-18-11-5-9(17)1-3-12(11)19(15)10-2-4-13-14(6-10)21-8-20-13/h1-6H,7-8H2 |
| InChIKey | LRMMLBKGWNKOAS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|