C14H9FIN3O2 — CID 66099411
1-(1,3-benzodioxol-5-yl)-6-fluoro-5-iodobenzimidazol-2-amine (PubChem CID 66099411) has the molecular formula C14H9FIN3O2 and a molecular weight of 397.15 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-6-fluoro-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-6-fluoro-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66099411 |
| Molecular Formula | C14H9FIN3O2 |
| Molecular Weight | 397.15 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-6-fluoro-5-iodobenzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)c(F)cc2n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H9FIN3O2/c15-8-4-11-10(5-9(8)16)18-14(17)19(11)7-1-2-12-13(3-7)21-6-20-12/h1-5H,6H2,(H2,17,18) |
| InChIKey | JRQVTDQGMFOPLY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|