C14H8BrFN2O2S — CID 66088783
3-(1,3-benzodioxol-5-yl)-6-bromo-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 66088783) has the molecular formula C14H8BrFN2O2S and a molecular weight of 367.20 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6-bromo-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6-bromo-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66088783 |
| Molecular Formula | C14H8BrFN2O2S |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6-bromo-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Br)[nH]c(=S)n2-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H8BrFN2O2S/c15-8-4-10-11(5-9(8)16)18(14(21)17-10)7-1-2-12-13(3-7)20-6-19-12/h1-5H,6H2,(H,17,21) |
| InChIKey | GQJRJFOSXWTHBB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|