C16H15ClIN3 — CID 66081464
2-(2-chloroethyl)-5-iodo-1-[(3-methyl-2-pyridinyl)methyl]benzimidazole (PubChem CID 66081464) has the molecular formula C16H15ClIN3 and a molecular weight of 411.67 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-iodo-1-[(3-methyl-2-pyridinyl)methyl]benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-iodo-1-[(3-methyl-2-pyridinyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 66081464 |
| Molecular Formula | C16H15ClIN3 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 2-(2-chloroethyl)-5-iodo-1-[(3-methyl-2-pyridinyl)methyl]benzimidazole |
| SMILES | Cc1cccnc1Cn1c(CCCl)nc2cc(I)ccc21 |
| InChI | InChI=1S/C16H15ClIN3/c1-11-3-2-8-19-14(11)10-21-15-5-4-12(18)9-13(15)20-16(21)6-7-17/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | HMQWQIIRYQCNQM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|