C32H40N2O6 — CID 6608364
(2S,3S,6R,11S)-11-benzyl-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(methoxymethyl)-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 6608364) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is (2S,3S,6R,11S)-11-benzyl-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(methoxymethyl)-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | (2S,3S,6R,11S)-11-benzyl-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(methoxymethyl)-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 6608364 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | (2S,3S,6R,11S)-11-benzyl-6-[2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-3-(methoxymethyl)-2-phenyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | COC[C@@H]1NC(=O)[C@@H](CC(=O)N2CCC[C@H]2CO)CC=CC[C@@H](Cc2ccccc2)C(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H40N2O6/c1-39-22-28-30(24-13-6-3-7-14-24)40-32(38)26(19-23-11-4-2-5-12-23)16-9-8-15-25(31(37)33-28)20-29(36)34-18-10-17-27(34)21-35/h2-9,11-14,25-28,30,35H,10,15-22H2,1H3,(H,33,37)/t25-,26+,27+,28+,30+/m1/s1 |
| InChIKey | ONQHBKWKGPSYCY-QUBFWBSFSA-N |
| XLogP | 3.60 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|