C14H15N3O4 — CID 66084325
N-[[4-(3,5-dioxopiperazine-1-carbonyl)phenyl]methyl]acetamide (PubChem CID 66084325) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[[4-(3,5-dioxopiperazine-1-carbonyl)phenyl]methyl]acetamide.
| Compound Name | N-[[4-(3,5-dioxopiperazine-1-carbonyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 66084325 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[[4-(3,5-dioxopiperazine-1-carbonyl)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)N2CC(=O)NC(=O)C2)cc1 |
| InChI | InChI=1S/C14H15N3O4/c1-9(18)15-6-10-2-4-11(5-3-10)14(21)17-7-12(19)16-13(20)8-17/h2-5H,6-8H2,1H3,(H,15,18)(H,16,19,20) |
| InChIKey | ASUHOPBDFODDLD-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|