C13H17N3O4 — CID 66085627
4-[3-(4-aminophenoxy)-2-hydroxypropyl]piperazine-2,6-dione (PubChem CID 66085627) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-[3-(4-aminophenoxy)-2-hydroxypropyl]piperazine-2,6-dione.
| Compound Name | 4-[3-(4-aminophenoxy)-2-hydroxypropyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66085627 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-[3-(4-aminophenoxy)-2-hydroxypropyl]piperazine-2,6-dione |
| SMILES | Nc1ccc(OCC(O)CN2CC(=O)NC(=O)C2)cc1 |
| InChI | InChI=1S/C13H17N3O4/c14-9-1-3-11(4-2-9)20-8-10(17)5-16-6-12(18)15-13(19)7-16/h1-4,10,17H,5-8,14H2,(H,15,18,19) |
| InChIKey | PANXLXYFUNCHFR-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|