C11H10FN3O2S — CID 66085779
4-(3,5-dioxopiperazin-1-yl)-3-fluorobenzenecarbothioamide (PubChem CID 66085779) has the molecular formula C11H10FN3O2S and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-(3,5-dioxopiperazin-1-yl)-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(3,5-dioxopiperazin-1-yl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 66085779 |
| Molecular Formula | C11H10FN3O2S |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-(3,5-dioxopiperazin-1-yl)-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CC(=O)NC(=O)C2)c(F)c1 |
| InChI | InChI=1S/C11H10FN3O2S/c12-7-3-6(11(13)18)1-2-8(7)15-4-9(16)14-10(17)5-15/h1-3H,4-5H2,(H2,13,18)(H,14,16,17) |
| InChIKey | RZQBKSSIGJZSFA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|