C13H11FN2O3S — CID 102689735
4-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-3-fluorobenzenecarbothioamide (PubChem CID 102689735) has the molecular formula C13H11FN2O3S and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 102689735 |
| Molecular Formula | C13H11FN2O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 4-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2C(=O)C3CCC(O3)C2=O)c(F)c1 |
| InChI | InChI=1S/C13H11FN2O3S/c14-7-5-6(11(15)20)1-2-8(7)16-12(17)9-3-4-10(19-9)13(16)18/h1-2,5,9-10H,3-4H2,(H2,15,20) |
| InChIKey | WLQUYQNLVQAGGJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|