C11H17IN2O — CID 66095407
1-N-(1-ethoxypropan-2-yl)-2-iodobenzene-1,4-diamine (PubChem CID 66095407) has the molecular formula C11H17IN2O and a molecular weight of 320.17 g/mol. Its IUPAC name is 1-N-(1-ethoxypropan-2-yl)-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-(1-ethoxypropan-2-yl)-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 66095407 |
| Molecular Formula | C11H17IN2O |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-N-(1-ethoxypropan-2-yl)-2-iodobenzene-1,4-diamine |
| SMILES | CCOCC(C)Nc1ccc(N)cc1I |
| InChI | InChI=1S/C11H17IN2O/c1-3-15-7-8(2)14-11-5-4-9(13)6-10(11)12/h4-6,8,14H,3,7,13H2,1-2H3 |
| InChIKey | WJSRCJVGNYHQES-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|