C13H22F3NO2 — CID 66096061
methyl 2-[1-(1-aminopropyl)-3-(trifluoromethyl)cyclohexyl]acetate (PubChem CID 66096061) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 2-[1-(1-aminopropyl)-3-(trifluoromethyl)cyclohexyl]acetate.
| Compound Name | methyl 2-[1-(1-aminopropyl)-3-(trifluoromethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 66096061 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl 2-[1-(1-aminopropyl)-3-(trifluoromethyl)cyclohexyl]acetate |
| SMILES | CCC(N)C1(CC(=O)OC)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H22F3NO2/c1-3-10(17)12(8-11(18)19-2)6-4-5-9(7-12)13(14,15)16/h9-10H,3-8,17H2,1-2H3 |
| InChIKey | NZCRWYVGHWJAFP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |