C13H19F3O4 — CID 125479072
3-[(3S)-1-(2-carboxyethyl)-3-(trifluoromethyl)cyclohexyl]propanoic acid (PubChem CID 125479072) has the molecular formula C13H19F3O4 and a molecular weight of 296.29 g/mol. Its IUPAC name is 3-[(3S)-1-(2-carboxyethyl)-3-(trifluoromethyl)cyclohexyl]propanoic acid.
| Compound Name | 3-[(3S)-1-(2-carboxyethyl)-3-(trifluoromethyl)cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 125479072 |
| Molecular Formula | C13H19F3O4 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[(3S)-1-(2-carboxyethyl)-3-(trifluoromethyl)cyclohexyl]propanoic acid |
| SMILES | O=C(O)CCC1(CCC(=O)O)CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C13H19F3O4/c14-13(15,16)9-2-1-5-12(8-9,6-3-10(17)18)7-4-11(19)20/h9H,1-8H2,(H,17,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | UTCISKVNONQYFI-VIFPVBQESA-N |
| XLogP | 3.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |