C14H27NO2 — CID 66096455
2-[1-(1-aminoethyl)-4-propan-2-ylcycloheptyl]acetic acid (PubChem CID 66096455) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)-4-propan-2-ylcycloheptyl]acetic acid.
| Compound Name | 2-[1-(1-aminoethyl)-4-propan-2-ylcycloheptyl]acetic acid |
|---|---|
| PubChem CID | 66096455 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2-[1-(1-aminoethyl)-4-propan-2-ylcycloheptyl]acetic acid |
| SMILES | CC(C)C1CCCC(CC(=O)O)(C(C)N)CC1 |
| InChI | InChI=1S/C14H27NO2/c1-10(2)12-5-4-7-14(8-6-12,11(3)15)9-13(16)17/h10-12H,4-9,15H2,1-3H3,(H,16,17) |
| InChIKey | FSOLCZNFIZFHFT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |