C11H20O3 — CID 83908321
2-(1-hydroxy-3-propan-2-ylcyclohexyl)acetic acid (PubChem CID 83908321) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(1-hydroxy-3-propan-2-ylcyclohexyl)acetic acid.
| Compound Name | 2-(1-hydroxy-3-propan-2-ylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 83908321 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-(1-hydroxy-3-propan-2-ylcyclohexyl)acetic acid |
| SMILES | CC(C)C1CCCC(O)(CC(=O)O)C1 |
| InChI | InChI=1S/C11H20O3/c1-8(2)9-4-3-5-11(14,6-9)7-10(12)13/h8-9,14H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | IZWCBMJJIXVVMQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |