4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid

C14H19NO4 — CID 66097078

IUPAC4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid
SMILESCC(N)C(CC(=O)O)c1ccc2c(c1)OCCCO2
InChIInChI=1S/C14H19NO4/c1-9(15)11(8-14(16)17)10-3-4-12-13(7-10)19-6-2-5-18-12/h3-4,7,9,11H,2,5-6,8,15H2,1H3,(H,16,17)
InChIKeySBTZAQJMBFVKML-UHFFFAOYSA-N
MW265.31 g/mol
LogP1.75
Rot. Bonds4

About 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid

4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid (PubChem CID 66097078) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid.

Molecular Properties

Compound Name4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid
PubChem CID66097078
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Name4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid
SMILESCC(N)C(CC(=O)O)c1ccc2c(c1)OCCCO2
InChIInChI=1S/C14H19NO4/c1-9(15)11(8-14(16)17)10-3-4-12-13(7-10)19-6-2-5-18-12/h3-4,7,9,11H,2,5-6,8,15H2,1H3,(H,16,17)
InChIKeySBTZAQJMBFVKML-UHFFFAOYSA-N
XLogP1.75
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid?
The IUPAC name of 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid (CID 66097078) is 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid.
What is the SMILES notation for 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid?
The canonical SMILES for 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid is CC(N)C(CC(=O)O)c1ccc2c(c1)OCCCO2.
What is the InChIKey of 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid?
The InChIKey is SBTZAQJMBFVKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-9(15)11(8-14(16)17)10-3-4-12-13(7-10)19-6-2-5-18-12/h3-4,7,9,11H,2,5-6,8,15H2,1H3,(H,16,17).
What are the key properties of 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid?
4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid has a molecular weight of 265.31 g/mol, XLogP of 1.75, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pentanoic acid is sourced from PubChem (CID 66097078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).