C15H23NS — CID 66098431
N-methyl-1-(2-methylphenyl)sulfanylhept-6-en-2-amine (PubChem CID 66098431) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N-methyl-1-(2-methylphenyl)sulfanylhept-6-en-2-amine.
| Compound Name | N-methyl-1-(2-methylphenyl)sulfanylhept-6-en-2-amine |
|---|---|
| PubChem CID | 66098431 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-methyl-1-(2-methylphenyl)sulfanylhept-6-en-2-amine |
| SMILES | C=CCCCC(CSc1ccccc1C)NC |
| InChI | InChI=1S/C15H23NS/c1-4-5-6-10-14(16-3)12-17-15-11-8-7-9-13(15)2/h4,7-9,11,14,16H,1,5-6,10,12H2,2-3H3 |
| InChIKey | TUFCDNHUWLECCZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|